About 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 166257719) has the molecular formula C11H10ClN5O
and a molecular weight of 263.69 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 166257719 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc(CNc2nc(Cl)nc3[nH]ccc23)no1 |
| InChI | InChI=1S/C11H10ClN5O/c1-6-4-7(17-18-6)5-14-10-8-2-3-13-9(8)15-11(12)16-10/h2-4H,5H2,1H3,(H2,13,14,15,16) |
| InChIKey | LIWVGPQDQNOFKX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 166257719) is 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is Cc1cc(CNc2nc(Cl)nc3[nH]ccc23)no1.
What is the InChIKey of 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is LIWVGPQDQNOFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN5O/c1-6-4-7(17-18-6)5-14-10-8-2-3-13-9(8)15-11(12)16-10/h2-4H,5H2,1H3,(H2,13,14,15,16).
What are the key properties of 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 263.69 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 166257719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).