About [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine
[4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine (PubChem CID 166257821) has the molecular formula C16H19N5
and a molecular weight of 281.36 g/mol. Its IUPAC name is [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine |
| PubChem CID | 166257821 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine |
| SMILES | Cc1cc(C)n(-c2ccc(-c3cnn(C)c3CN)cc2)n1 |
| InChI | InChI=1S/C16H19N5/c1-11-8-12(2)21(19-11)14-6-4-13(5-7-14)15-10-18-20(3)16(15)9-17/h4-8,10H,9,17H2,1-3H3 |
| InChIKey | YXTUTEAAOBXODU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine?
The IUPAC name of [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine (CID 166257821) is [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine.
What is the SMILES notation for [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine?
The canonical SMILES for [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine is Cc1cc(C)n(-c2ccc(-c3cnn(C)c3CN)cc2)n1.
What is the InChIKey of [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine?
The InChIKey is YXTUTEAAOBXODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5/c1-11-8-12(2)21(19-11)14-6-4-13(5-7-14)15-10-18-20(3)16(15)9-17/h4-8,10H,9,17H2,1-3H3.
What are the key properties of [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine?
[4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine has a molecular weight of 281.36 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-methylpyrazol-5-yl]methanamine is sourced from PubChem (CID 166257821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).