C24H22N2O — CID 8003571
3,5-dimethyl-1-[4-[(4-phenylphenoxy)methyl]phenyl]pyrazole (PubChem CID 8003571) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 3,5-dimethyl-1-[4-[(4-phenylphenoxy)methyl]phenyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[4-[(4-phenylphenoxy)methyl]phenyl]pyrazole |
|---|---|
| PubChem CID | 8003571 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3,5-dimethyl-1-[4-[(4-phenylphenoxy)methyl]phenyl]pyrazole |
| SMILES | Cc1cc(C)n(-c2ccc(COc3ccc(-c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C24H22N2O/c1-18-16-19(2)26(25-18)23-12-8-20(9-13-23)17-27-24-14-10-22(11-15-24)21-6-4-3-5-7-21/h3-16H,17H2,1-2H3 |
| InChIKey | CFGNMOFHZWADKC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |