C16H18FN3O2 — CID 166257992
5-[[1-(cyclobutylmethyl)pyrazol-4-yl]methylamino]-2-fluorobenzoic acid (PubChem CID 166257992) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 5-[[1-(cyclobutylmethyl)pyrazol-4-yl]methylamino]-2-fluorobenzoic acid.
| Compound Name | 5-[[1-(cyclobutylmethyl)pyrazol-4-yl]methylamino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 166257992 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 5-[[1-(cyclobutylmethyl)pyrazol-4-yl]methylamino]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(NCc2cnn(CC3CCC3)c2)ccc1F |
| InChI | InChI=1S/C16H18FN3O2/c17-15-5-4-13(6-14(15)16(21)22)18-7-12-8-19-20(10-12)9-11-2-1-3-11/h4-6,8,10-11,18H,1-3,7,9H2,(H,21,22) |
| InChIKey | ZJCREZCKPNMBQD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |