C22H29N5O2 — CID 166259470
1-(2-aminoethyl)-3-[1-[3-(2-oxoimidazolidin-1-yl)phenyl]ethyl]-1-(2-phenylethyl)urea (PubChem CID 166259470) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-[1-[3-(2-oxoimidazolidin-1-yl)phenyl]ethyl]-1-(2-phenylethyl)urea.
| Compound Name | 1-(2-aminoethyl)-3-[1-[3-(2-oxoimidazolidin-1-yl)phenyl]ethyl]-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 166259470 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 1-(2-aminoethyl)-3-[1-[3-(2-oxoimidazolidin-1-yl)phenyl]ethyl]-1-(2-phenylethyl)urea |
| SMILES | CC(NC(=O)N(CCN)CCc1ccccc1)c1cccc(N2CCNC2=O)c1 |
| InChI | InChI=1S/C22H29N5O2/c1-17(19-8-5-9-20(16-19)27-15-12-24-21(27)28)25-22(29)26(14-11-23)13-10-18-6-3-2-4-7-18/h2-9,16-17H,10-15,23H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | RFILMRXWCRWSPF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |