C14H18F3N3O2S — CID 166260272
N-(2,1,3-benzothiadiazol-5-ylmethyl)pentan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 166260272) has the molecular formula C14H18F3N3O2S and a molecular weight of 349.38 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-ylmethyl)pentan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2,1,3-benzothiadiazol-5-ylmethyl)pentan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166260272 |
| Molecular Formula | C14H18F3N3O2S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-ylmethyl)pentan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCNCc1ccc2nsnc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17N3S.C2HF3O2/c1-2-3-4-7-13-9-10-5-6-11-12(8-10)15-16-14-11;3-2(4,5)1(6)7/h5-6,8,13H,2-4,7,9H2,1H3;(H,6,7) |
| InChIKey | ZBFDBUOWTYRQQL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|