About 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol
1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol (PubChem CID 166260412) has the molecular formula C15H18ClN3O
and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol |
| PubChem CID | 166260412 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol |
| SMILES | CC1(C)CN(c2cc(Cl)c3cccnc3n2)CCC1O |
| InChI | InChI=1S/C15H18ClN3O/c1-15(2)9-19(7-5-12(15)20)13-8-11(16)10-4-3-6-17-14(10)18-13/h3-4,6,8,12,20H,5,7,9H2,1-2H3 |
| InChIKey | OHTPHFAQEXYEID-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol?
The IUPAC name of 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol (CID 166260412) is 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol.
What is the SMILES notation for 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol?
The canonical SMILES for 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol is CC1(C)CN(c2cc(Cl)c3cccnc3n2)CCC1O.
What is the InChIKey of 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol?
The InChIKey is OHTPHFAQEXYEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O/c1-15(2)9-19(7-5-12(15)20)13-8-11(16)10-4-3-6-17-14(10)18-13/h3-4,6,8,12,20H,5,7,9H2,1-2H3.
What are the key properties of 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol?
1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol has a molecular weight of 291.78 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 166260412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).