C15H18ClN3O — CID 166260412
1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol (PubChem CID 166260412) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol.
| Compound Name | 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 166260412 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(4-chloro-1,8-naphthyridin-2-yl)-3,3-dimethylpiperidin-4-ol |
| SMILES | CC1(C)CN(c2cc(Cl)c3cccnc3n2)CCC1O |
| InChI | InChI=1S/C15H18ClN3O/c1-15(2)9-19(7-5-12(15)20)13-8-11(16)10-4-3-6-17-14(10)18-13/h3-4,6,8,12,20H,5,7,9H2,1-2H3 |
| InChIKey | OHTPHFAQEXYEID-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |