C22H26N2O3 — CID 166262628
2-quinolin-7-ylethyl 4-(cyclopropanecarbonylamino)cyclohexane-1-carboxylate (PubChem CID 166262628) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-quinolin-7-ylethyl 4-(cyclopropanecarbonylamino)cyclohexane-1-carboxylate.
| Compound Name | 2-quinolin-7-ylethyl 4-(cyclopropanecarbonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 166262628 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-quinolin-7-ylethyl 4-(cyclopropanecarbonylamino)cyclohexane-1-carboxylate |
| SMILES | O=C(NC1CCC(C(=O)OCCc2ccc3cccnc3c2)CC1)C1CC1 |
| InChI | InChI=1S/C22H26N2O3/c25-21(17-5-6-17)24-19-9-7-18(8-10-19)22(26)27-13-11-15-3-4-16-2-1-12-23-20(16)14-15/h1-4,12,14,17-19H,5-11,13H2,(H,24,25) |
| InChIKey | IQYJCWTUJOTCLV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |