About 2-quinolin-7-ylethyl cyclopropanecarboxylate
2-quinolin-7-ylethyl cyclopropanecarboxylate (PubChem CID 155955554) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-quinolin-7-ylethyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 2-quinolin-7-ylethyl cyclopropanecarboxylate |
| PubChem CID | 155955554 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-quinolin-7-ylethyl cyclopropanecarboxylate |
| SMILES | O=C(OCCc1ccc2cccnc2c1)C1CC1 |
| InChI | InChI=1S/C15H15NO2/c17-15(13-5-6-13)18-9-7-11-3-4-12-2-1-8-16-14(12)10-11/h1-4,8,10,13H,5-7,9H2 |
| InChIKey | KYLVRSAIGUSNRZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-quinolin-7-ylethyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-7-ylethyl cyclopropanecarboxylate?
The IUPAC name of 2-quinolin-7-ylethyl cyclopropanecarboxylate (CID 155955554) is 2-quinolin-7-ylethyl cyclopropanecarboxylate.
What is the SMILES notation for 2-quinolin-7-ylethyl cyclopropanecarboxylate?
The canonical SMILES for 2-quinolin-7-ylethyl cyclopropanecarboxylate is O=C(OCCc1ccc2cccnc2c1)C1CC1.
What is the InChIKey of 2-quinolin-7-ylethyl cyclopropanecarboxylate?
The InChIKey is KYLVRSAIGUSNRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c17-15(13-5-6-13)18-9-7-11-3-4-12-2-1-8-16-14(12)10-11/h1-4,8,10,13H,5-7,9H2.
What are the key properties of 2-quinolin-7-ylethyl cyclopropanecarboxylate?
2-quinolin-7-ylethyl cyclopropanecarboxylate has a molecular weight of 241.29 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-7-ylethyl cyclopropanecarboxylate is sourced from PubChem (CID 155955554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).