C12H15N3O3S — CID 166263763
2-[(3-methoxy-1-methylpyrazol-4-yl)methylamino]-2-thiophen-2-ylacetic acid (PubChem CID 166263763) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[(3-methoxy-1-methylpyrazol-4-yl)methylamino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(3-methoxy-1-methylpyrazol-4-yl)methylamino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 166263763 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[(3-methoxy-1-methylpyrazol-4-yl)methylamino]-2-thiophen-2-ylacetic acid |
| SMILES | COc1nn(C)cc1CNC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H15N3O3S/c1-15-7-8(11(14-15)18-2)6-13-10(12(16)17)9-4-3-5-19-9/h3-5,7,10,13H,6H2,1-2H3,(H,16,17) |
| InChIKey | NOYJCGWXLHCSLG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |