C20H21N3O3S — CID 166265508
7-[[(3aS,5S,6aS)-5-(hydroxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 166265508) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 7-[[(3aS,5S,6aS)-5-(hydroxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[(3aS,5S,6aS)-5-(hydroxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 166265508 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 7-[[(3aS,5S,6aS)-5-(hydroxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-yl]methyl]-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(CN2[C@H](CO)C[C@@H]3OCC[C@@H]32)nc2scc(-c3ccccc3)n12 |
| InChI | InChI=1S/C20H21N3O3S/c24-11-15-9-18-16(6-7-26-18)22(15)10-14-8-19(25)23-17(12-27-20(23)21-14)13-4-2-1-3-5-13/h1-5,8,12,15-16,18,24H,6-7,9-11H2/t15-,16-,18-/m0/s1 |
| InChIKey | WWHMKTBMFGSMGE-BQFCYCMXSA-N |
| XLogP | 2.15 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |