C16H23N3O3S — CID 166266068
2-methoxy-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide (PubChem CID 166266068) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-methoxy-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide.
| Compound Name | 2-methoxy-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 166266068 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-methoxy-N-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]butane-1-sulfonamide |
| SMILES | CCC(CS(=O)(=O)Nc1ccn(Cc2ccccc2C)n1)OC |
| InChI | InChI=1S/C16H23N3O3S/c1-4-15(22-3)12-23(20,21)18-16-9-10-19(17-16)11-14-8-6-5-7-13(14)2/h5-10,15H,4,11-12H2,1-3H3,(H,17,18) |
| InChIKey | PKLRGDDVTRAGQR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |