C22H26N2O5 — CID 166267199
2-[1-[2-[4-(3-methylphenoxy)anilino]-2-oxoethyl]piperidin-4-yl]oxyacetic acid (PubChem CID 166267199) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-[1-[2-[4-(3-methylphenoxy)anilino]-2-oxoethyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[2-[4-(3-methylphenoxy)anilino]-2-oxoethyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 166267199 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[1-[2-[4-(3-methylphenoxy)anilino]-2-oxoethyl]piperidin-4-yl]oxyacetic acid |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)CN3CCC(OCC(=O)O)CC3)cc2)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-16-3-2-4-20(13-16)29-19-7-5-17(6-8-19)23-21(25)14-24-11-9-18(10-12-24)28-15-22(26)27/h2-8,13,18H,9-12,14-15H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | KMQFQSLLADBKPD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |