C16H19NO5S — CID 166267226
3-methoxy-2-methyl-2-[(4-methylnaphthalen-1-yl)sulfonylamino]propanoic acid (PubChem CID 166267226) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-methoxy-2-methyl-2-[(4-methylnaphthalen-1-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-methoxy-2-methyl-2-[(4-methylnaphthalen-1-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 166267226 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-methoxy-2-methyl-2-[(4-methylnaphthalen-1-yl)sulfonylamino]propanoic acid |
| SMILES | COCC(C)(NS(=O)(=O)c1ccc(C)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H19NO5S/c1-11-8-9-14(13-7-5-4-6-12(11)13)23(20,21)17-16(2,10-22-3)15(18)19/h4-9,17H,10H2,1-3H3,(H,18,19) |
| InChIKey | VBHZECUHGWBEMD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |