C15H17NO5S — CID 166267297
4-[(2,4-dimethylfuran-3-yl)methylsulfamoyl]-2-methylbenzoic acid (PubChem CID 166267297) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-[(2,4-dimethylfuran-3-yl)methylsulfamoyl]-2-methylbenzoic acid.
| Compound Name | 4-[(2,4-dimethylfuran-3-yl)methylsulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 166267297 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-[(2,4-dimethylfuran-3-yl)methylsulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCc2c(C)coc2C)ccc1C(=O)O |
| InChI | InChI=1S/C15H17NO5S/c1-9-6-12(4-5-13(9)15(17)18)22(19,20)16-7-14-10(2)8-21-11(14)3/h4-6,8,16H,7H2,1-3H3,(H,17,18) |
| InChIKey | FAZPCMQQYKJDPO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |