C19H22ClN5 — CID 166267444
1-[(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-3-phenylpyrrolidin-3-amine (PubChem CID 166267444) has the molecular formula C19H22ClN5 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-3-phenylpyrrolidin-3-amine.
| Compound Name | 1-[(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-3-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 166267444 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]-3-phenylpyrrolidin-3-amine |
| SMILES | Cc1nn(C)c2nc(Cl)c(CN3CCC(N)(c4ccccc4)C3)cc12 |
| InChI | InChI=1S/C19H22ClN5/c1-13-16-10-14(17(20)22-18(16)24(2)23-13)11-25-9-8-19(21,12-25)15-6-4-3-5-7-15/h3-7,10H,8-9,11-12,21H2,1-2H3 |
| InChIKey | BMPXHDBJJBGRAG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|