C24H22F2N6O2 — CID 16626755
1,7-bis[(2-fluorophenyl)methyl]-3,4,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 16626755) has the molecular formula C24H22F2N6O2 and a molecular weight of 464.48 g/mol. Its IUPAC name is 1,7-bis[(2-fluorophenyl)methyl]-3,4,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1,7-bis[(2-fluorophenyl)methyl]-3,4,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 16626755 |
| Molecular Formula | C24H22F2N6O2 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1,7-bis[(2-fluorophenyl)methyl]-3,4,9-trimethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1=NN(Cc2ccccc2F)c2nc3c(c(=O)n(Cc4ccccc4F)c(=O)n3C)n2C1C |
| InChI | InChI=1S/C24H22F2N6O2/c1-14-15(2)32-20-21(27-23(32)31(28-14)13-17-9-5-7-11-19(17)26)29(3)24(34)30(22(20)33)12-16-8-4-6-10-18(16)25/h4-11,15H,12-13H2,1-3H3 |
| InChIKey | PBGOIIKAAHSPIE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |