C24H26N6O3 — CID 41334218
(4R)-1-(2-methoxyethyl)-3,4,9-trimethyl-7-(naphthalen-1-ylmethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 41334218) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is (4R)-1-(2-methoxyethyl)-3,4,9-trimethyl-7-(naphthalen-1-ylmethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4R)-1-(2-methoxyethyl)-3,4,9-trimethyl-7-(naphthalen-1-ylmethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 41334218 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (4R)-1-(2-methoxyethyl)-3,4,9-trimethyl-7-(naphthalen-1-ylmethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | COCCN1N=C(C)[C@@H](C)n2c1nc1c2c(=O)n(Cc2cccc3ccccc23)c(=O)n1C |
| InChI | InChI=1S/C24H26N6O3/c1-15-16(2)30-20-21(25-23(30)29(26-15)12-13-33-4)27(3)24(32)28(22(20)31)14-18-10-7-9-17-8-5-6-11-19(17)18/h5-11,16H,12-14H2,1-4H3/t16-/m1/s1 |
| InChIKey | IMUXDJKJGKGRTF-MRXNPFEDSA-N |
| XLogP | 2.50 |
| TPSA | 86.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |