C18H19ClN2O3 — CID 166270839
methyl 5-[[(3R)-3-(3-chlorophenoxy)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate (PubChem CID 166270839) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is methyl 5-[[(3R)-3-(3-chlorophenoxy)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[(3R)-3-(3-chlorophenoxy)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166270839 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methyl 5-[[(3R)-3-(3-chlorophenoxy)pyrrolidin-1-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CC[C@@H](Oc3cccc(Cl)c3)C2)cn1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-23-18(22)17-6-5-13(10-20-17)11-21-8-7-16(12-21)24-15-4-2-3-14(19)9-15/h2-6,9-10,16H,7-8,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | AJJSOUWMIRQTBE-MRXNPFEDSA-N |
| XLogP | 3.17 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |