C13H18N4O2 — CID 166272647
[(1S,2S,4R)-2-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)methanone (PubChem CID 166272647) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is [(1S,2S,4R)-2-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)methanone.
| Compound Name | [(1S,2S,4R)-2-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)methanone |
|---|---|
| PubChem CID | 166272647 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [(1S,2S,4R)-2-methyl-7-oxabicyclo[2.2.1]heptan-2-yl]-(2,5,6,7-tetrahydrotriazolo[4,5-b]pyridin-4-yl)methanone |
| SMILES | C[C@]1(C(=O)N2CCCc3n[nH]nc32)C[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C13H18N4O2/c1-13(7-8-4-5-10(13)19-8)12(18)17-6-2-3-9-11(17)15-16-14-9/h8,10H,2-7H2,1H3,(H,14,15,16)/t8-,10+,13+/m1/s1 |
| InChIKey | GTSNUKBQPBWVGR-DVYJOKAKSA-N |
| XLogP | 1.04 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |