C20H22N4O3S — CID 166272664
N-[2-(1H-indazol-5-yl)ethyl]-1,3,3-trimethyl-2-oxoindole-5-sulfonamide (PubChem CID 166272664) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[2-(1H-indazol-5-yl)ethyl]-1,3,3-trimethyl-2-oxoindole-5-sulfonamide.
| Compound Name | N-[2-(1H-indazol-5-yl)ethyl]-1,3,3-trimethyl-2-oxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 166272664 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[2-(1H-indazol-5-yl)ethyl]-1,3,3-trimethyl-2-oxoindole-5-sulfonamide |
| SMILES | CN1C(=O)C(C)(C)c2cc(S(=O)(=O)NCCc3ccc4[nH]ncc4c3)ccc21 |
| InChI | InChI=1S/C20H22N4O3S/c1-20(2)16-11-15(5-7-18(16)24(3)19(20)25)28(26,27)22-9-8-13-4-6-17-14(10-13)12-21-23-17/h4-7,10-12,22H,8-9H2,1-3H3,(H,21,23) |
| InChIKey | BDEFWROVOXPESL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |