C19H21F2N3O3 — CID 166274408
2-[(3,3-difluoro-2-phenylpropyl)carbamoylamino]-4-pyridin-4-ylbutanoic acid (PubChem CID 166274408) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[(3,3-difluoro-2-phenylpropyl)carbamoylamino]-4-pyridin-4-ylbutanoic acid.
| Compound Name | 2-[(3,3-difluoro-2-phenylpropyl)carbamoylamino]-4-pyridin-4-ylbutanoic acid |
|---|---|
| PubChem CID | 166274408 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[(3,3-difluoro-2-phenylpropyl)carbamoylamino]-4-pyridin-4-ylbutanoic acid |
| SMILES | O=C(NCC(c1ccccc1)C(F)F)NC(CCc1ccncc1)C(=O)O |
| InChI | InChI=1S/C19H21F2N3O3/c20-17(21)15(14-4-2-1-3-5-14)12-23-19(27)24-16(18(25)26)7-6-13-8-10-22-11-9-13/h1-5,8-11,15-17H,6-7,12H2,(H,25,26)(H2,23,24,27) |
| InChIKey | LEDVTDYDPXPINH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |