C23H22N2O3 — CID 70278068
(2R)-2-[(2,2-diphenylacetyl)amino]-4-pyridin-4-ylbutanoic acid (PubChem CID 70278068) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2R)-2-[(2,2-diphenylacetyl)amino]-4-pyridin-4-ylbutanoic acid.
| Compound Name | (2R)-2-[(2,2-diphenylacetyl)amino]-4-pyridin-4-ylbutanoic acid |
|---|---|
| PubChem CID | 70278068 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2R)-2-[(2,2-diphenylacetyl)amino]-4-pyridin-4-ylbutanoic acid |
| SMILES | O=C(N[C@H](CCc1ccncc1)C(=O)O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O3/c26-22(25-20(23(27)28)12-11-17-13-15-24-16-14-17)21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,13-16,20-21H,11-12H2,(H,25,26)(H,27,28)/t20-/m1/s1 |
| InChIKey | OMSNCIZMKXMTJO-HXUWFJFHSA-N |
| XLogP | 3.42 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |