C17H19FN2O2S — CID 166274695
(3S,3aS,6aR)-5-[(1-fluoronaphthalen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine (PubChem CID 166274695) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-[(1-fluoronaphthalen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine.
| Compound Name | (3S,3aS,6aR)-5-[(1-fluoronaphthalen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
|---|---|
| PubChem CID | 166274695 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (3S,3aS,6aR)-5-[(1-fluoronaphthalen-2-yl)methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
| SMILES | N[C@@H]1CS(=O)(=O)[C@H]2CN(Cc3ccc4ccccc4c3F)C[C@@H]12 |
| InChI | InChI=1S/C17H19FN2O2S/c18-17-12(6-5-11-3-1-2-4-13(11)17)7-20-8-14-15(19)10-23(21,22)16(14)9-20/h1-6,14-16H,7-10,19H2/t14-,15+,16-/m0/s1 |
| InChIKey | YXTKFJOQXYOTOH-XHSDSOJGSA-N |
| XLogP | 1.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |