C16H23FN2O2S — CID 154822885
(3S,3aS,6aR)-5-[(4-fluoro-2-methylphenyl)methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine (PubChem CID 154822885) has the molecular formula C16H23FN2O2S and a molecular weight of 326.44 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-[(4-fluoro-2-methylphenyl)methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine.
| Compound Name | (3S,3aS,6aR)-5-[(4-fluoro-2-methylphenyl)methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
|---|---|
| PubChem CID | 154822885 |
| Molecular Formula | C16H23FN2O2S |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3S,3aS,6aR)-5-[(4-fluoro-2-methylphenyl)methyl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
| SMILES | Cc1cc(F)ccc1CN1C[C@H]2[C@H](N(C)C)CS(=O)(=O)[C@H]2C1 |
| InChI | InChI=1S/C16H23FN2O2S/c1-11-6-13(17)5-4-12(11)7-19-8-14-15(18(2)3)10-22(20,21)16(14)9-19/h4-6,14-16H,7-10H2,1-3H3/t14-,15+,16-/m0/s1 |
| InChIKey | XPKAVZLPMUJQHC-XHSDSOJGSA-N |
| XLogP | 1.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |