C16H18F3NO2S — CID 118699152
2-benzyl-5-(trifluoromethylsulfonylmethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole (PubChem CID 118699152) has the molecular formula C16H18F3NO2S and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-benzyl-5-(trifluoromethylsulfonylmethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-benzyl-5-(trifluoromethylsulfonylmethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 118699152 |
| Molecular Formula | C16H18F3NO2S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-benzyl-5-(trifluoromethylsulfonylmethyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole |
| SMILES | O=S(=O)(CC1=CC2CN(Cc3ccccc3)CC2C1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO2S/c17-16(18,19)23(21,22)11-13-6-14-9-20(10-15(14)7-13)8-12-4-2-1-3-5-12/h1-6,14-15H,7-11H2 |
| InChIKey | PMSIXFOCWUXACC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|