C16H21FN2O2S — CID 125256473
(3aR,6aR)-4-cyclopropylsulfonyl-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 125256473) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is (3aR,6aR)-4-cyclopropylsulfonyl-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aR)-4-cyclopropylsulfonyl-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 125256473 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (3aR,6aR)-4-cyclopropylsulfonyl-1-[(4-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | O=S(=O)(C1CC1)N1CC[C@@H]2[C@H]1CCN2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O2S/c17-13-3-1-12(2-4-13)11-18-9-7-16-15(18)8-10-19(16)22(20,21)14-5-6-14/h1-4,14-16H,5-11H2/t15-,16-/m1/s1 |
| InChIKey | GHXMTDCFQAFDCJ-HZPDHXFCSA-N |
| XLogP | 1.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |