C19H26N2O4 — CID 166275818
2-methyl-3-[(3S)-3-morpholin-4-ylazepane-1-carbonyl]benzoic acid (PubChem CID 166275818) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-methyl-3-[(3S)-3-morpholin-4-ylazepane-1-carbonyl]benzoic acid.
| Compound Name | 2-methyl-3-[(3S)-3-morpholin-4-ylazepane-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 166275818 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-methyl-3-[(3S)-3-morpholin-4-ylazepane-1-carbonyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)N1CCCC[C@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C19H26N2O4/c1-14-16(6-4-7-17(14)19(23)24)18(22)21-8-3-2-5-15(13-21)20-9-11-25-12-10-20/h4,6-7,15H,2-3,5,8-13H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | RPUYNTGOMCDDPF-HNNXBMFYSA-N |
| XLogP | 2.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |