C16H15F3N4O — CID 166277278
N-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-2-[2-(trifluoromethyl)phenoxy]ethanamine (PubChem CID 166277278) has the molecular formula C16H15F3N4O and a molecular weight of 336.32 g/mol. Its IUPAC name is N-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-2-[2-(trifluoromethyl)phenoxy]ethanamine.
| Compound Name | N-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-2-[2-(trifluoromethyl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 166277278 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-([1,2,4]triazolo[1,5-a]pyridin-5-ylmethyl)-2-[2-(trifluoromethyl)phenoxy]ethanamine |
| SMILES | FC(F)(F)c1ccccc1OCCNCc1cccc2ncnn12 |
| InChI | InChI=1S/C16H15F3N4O/c17-16(18,19)13-5-1-2-6-14(13)24-9-8-20-10-12-4-3-7-15-21-11-22-23(12)15/h1-7,11,20H,8-10H2 |
| InChIKey | VPNSAUDZWBXSDS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|