C15H18N2O4 — CID 166278055
(2S)-1-(3-phenylmethoxyazetidine-1-carbonyl)azetidine-2-carboxylic acid (PubChem CID 166278055) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is (2S)-1-(3-phenylmethoxyazetidine-1-carbonyl)azetidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-phenylmethoxyazetidine-1-carbonyl)azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 166278055 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2S)-1-(3-phenylmethoxyazetidine-1-carbonyl)azetidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCN1C(=O)N1CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H18N2O4/c18-14(19)13-6-7-17(13)15(20)16-8-12(9-16)21-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,18,19)/t13-/m0/s1 |
| InChIKey | FFXXTFSPLCJIDA-ZDUSSCGKSA-N |
| XLogP | 1.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |