C15H23N5O2S — CID 166281664
N-[3-(2-oxo-1,3-diazinan-1-yl)propyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 166281664) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[3-(2-oxo-1,3-diazinan-1-yl)propyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-(2-oxo-1,3-diazinan-1-yl)propyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166281664 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[3-(2-oxo-1,3-diazinan-1-yl)propyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCN1CCCNC1=O)C1CCCN1c1nccs1 |
| InChI | InChI=1S/C15H23N5O2S/c21-13(12-4-1-10-20(12)15-18-7-11-23-15)16-5-2-8-19-9-3-6-17-14(19)22/h7,11-12H,1-6,8-10H2,(H,16,21)(H,17,22) |
| InChIKey | VSKYZDRNJIIDKU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|