C23H33N5OS — CID 112822352
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 112822352) has the molecular formula C23H33N5OS and a molecular weight of 427.62 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 112822352 |
| Molecular Formula | C23H33N5OS |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)C3CCCN3c3nccs3)CC2)c1 |
| InChI | InChI=1S/C23H33N5OS/c1-19-6-4-7-20(18-19)27-15-13-26(14-16-27)11-3-2-9-24-22(29)21-8-5-12-28(21)23-25-10-17-30-23/h4,6-7,10,17-18,21H,2-3,5,8-9,11-16H2,1H3,(H,24,29) |
| InChIKey | JABKZNFAFLQFBX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|