C18H24FNO4 — CID 166284035
1-[3-(2-fluoro-3-hydroxyphenyl)piperidin-1-yl]-2-(oxan-3-yloxy)ethanone (PubChem CID 166284035) has the molecular formula C18H24FNO4 and a molecular weight of 337.39 g/mol. Its IUPAC name is 1-[3-(2-fluoro-3-hydroxyphenyl)piperidin-1-yl]-2-(oxan-3-yloxy)ethanone.
| Compound Name | 1-[3-(2-fluoro-3-hydroxyphenyl)piperidin-1-yl]-2-(oxan-3-yloxy)ethanone |
|---|---|
| PubChem CID | 166284035 |
| Molecular Formula | C18H24FNO4 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[3-(2-fluoro-3-hydroxyphenyl)piperidin-1-yl]-2-(oxan-3-yloxy)ethanone |
| SMILES | O=C(COC1CCCOC1)N1CCCC(c2cccc(O)c2F)C1 |
| InChI | InChI=1S/C18H24FNO4/c19-18-15(6-1-7-16(18)21)13-4-2-8-20(10-13)17(22)12-24-14-5-3-9-23-11-14/h1,6-7,13-14,21H,2-5,8-12H2 |
| InChIKey | OINXENDOMKFFDP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |