C17H17FN4O — CID 166284474
N-[4-(4-cyanopyrazol-1-yl)phenyl]-4-fluorocyclohexane-1-carboxamide (PubChem CID 166284474) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is N-[4-(4-cyanopyrazol-1-yl)phenyl]-4-fluorocyclohexane-1-carboxamide.
| Compound Name | N-[4-(4-cyanopyrazol-1-yl)phenyl]-4-fluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166284474 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[4-(4-cyanopyrazol-1-yl)phenyl]-4-fluorocyclohexane-1-carboxamide |
| SMILES | N#Cc1cnn(-c2ccc(NC(=O)C3CCC(F)CC3)cc2)c1 |
| InChI | InChI=1S/C17H17FN4O/c18-14-3-1-13(2-4-14)17(23)21-15-5-7-16(8-6-15)22-11-12(9-19)10-20-22/h5-8,10-11,13-14H,1-4H2,(H,21,23) |
| InChIKey | FNBDUWMCVQREFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |