C18H12Cl2N4O — CID 155063425
N-[4-(4-cyanopyrazol-1-yl)phenyl]-2-(2,5-dichlorophenyl)acetamide (PubChem CID 155063425) has the molecular formula C18H12Cl2N4O and a molecular weight of 371.23 g/mol. Its IUPAC name is N-[4-(4-cyanopyrazol-1-yl)phenyl]-2-(2,5-dichlorophenyl)acetamide.
| Compound Name | N-[4-(4-cyanopyrazol-1-yl)phenyl]-2-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 155063425 |
| Molecular Formula | C18H12Cl2N4O |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[4-(4-cyanopyrazol-1-yl)phenyl]-2-(2,5-dichlorophenyl)acetamide |
| SMILES | N#Cc1cnn(-c2ccc(NC(=O)Cc3cc(Cl)ccc3Cl)cc2)c1 |
| InChI | InChI=1S/C18H12Cl2N4O/c19-14-1-6-17(20)13(7-14)8-18(25)23-15-2-4-16(5-3-15)24-11-12(9-21)10-22-24/h1-7,10-11H,8H2,(H,23,25) |
| InChIKey | AKYXMJSQXNUPIO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |