C20H26N2O4 — CID 166284807
3-cyclobutyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 166284807) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-cyclobutyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-cyclobutyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166284807 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-cyclobutyl-1-(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(c1cc2c([nH]c1=O)CCCCC2)N1CCC(C(=O)O)(C2CCC2)C1 |
| InChI | InChI=1S/C20H26N2O4/c23-17-15(11-13-5-2-1-3-8-16(13)21-17)18(24)22-10-9-20(12-22,19(25)26)14-6-4-7-14/h11,14H,1-10,12H2,(H,21,23)(H,25,26) |
| InChIKey | KMKPVAKHMFHKLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |