C15H15ClFNO4 — CID 166284840
1-[[[2-(4-chloro-2-fluorophenyl)-2-hydroxyacetyl]amino]methyl]cyclopent-3-ene-1-carboxylic acid (PubChem CID 166284840) has the molecular formula C15H15ClFNO4 and a molecular weight of 327.74 g/mol. Its IUPAC name is 1-[[[2-(4-chloro-2-fluorophenyl)-2-hydroxyacetyl]amino]methyl]cyclopent-3-ene-1-carboxylic acid.
| Compound Name | 1-[[[2-(4-chloro-2-fluorophenyl)-2-hydroxyacetyl]amino]methyl]cyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166284840 |
| Molecular Formula | C15H15ClFNO4 |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-[[[2-(4-chloro-2-fluorophenyl)-2-hydroxyacetyl]amino]methyl]cyclopent-3-ene-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CC=CC1)C(O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H15ClFNO4/c16-9-3-4-10(11(17)7-9)12(19)13(20)18-8-15(14(21)22)5-1-2-6-15/h1-4,7,12,19H,5-6,8H2,(H,18,20)(H,21,22) |
| InChIKey | MVQKNKOVRNFDBA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|