C21H36N4O2 — CID 166286453
2-[4-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-methylpropanoyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide (PubChem CID 166286453) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-methylpropanoyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-methylpropanoyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 166286453 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 2-[4-[2-(2,5-dihydro-1H-pyrrol-3-yl)-2-methylpropanoyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide |
| SMILES | CC1CCCC(NC(=O)CN2CCN(C(=O)C(C)(C)C3=CCNC3)CC2)C1 |
| InChI | InChI=1S/C21H36N4O2/c1-16-5-4-6-18(13-16)23-19(26)15-24-9-11-25(12-10-24)20(27)21(2,3)17-7-8-22-14-17/h7,16,18,22H,4-6,8-15H2,1-3H3,(H,23,26) |
| InChIKey | ITTMQCSSHINWGT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|