C18H22FN3O — CID 166286651
N-[(8-fluoroquinolin-3-yl)methyl]-3,3-dimethylpiperidine-2-carboxamide (PubChem CID 166286651) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is N-[(8-fluoroquinolin-3-yl)methyl]-3,3-dimethylpiperidine-2-carboxamide.
| Compound Name | N-[(8-fluoroquinolin-3-yl)methyl]-3,3-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 166286651 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[(8-fluoroquinolin-3-yl)methyl]-3,3-dimethylpiperidine-2-carboxamide |
| SMILES | CC1(C)CCCNC1C(=O)NCc1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C18H22FN3O/c1-18(2)7-4-8-20-16(18)17(23)22-11-12-9-13-5-3-6-14(19)15(13)21-10-12/h3,5-6,9-10,16,20H,4,7-8,11H2,1-2H3,(H,22,23) |
| InChIKey | ISJYOGITUVNTDX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |