C17H20ClFN4O — CID 166287232
3-chloro-2-fluoro-N-[(3R)-1-[(3-methylimidazol-4-yl)methyl]piperidin-3-yl]benzamide (PubChem CID 166287232) has the molecular formula C17H20ClFN4O and a molecular weight of 350.83 g/mol. Its IUPAC name is 3-chloro-2-fluoro-N-[(3R)-1-[(3-methylimidazol-4-yl)methyl]piperidin-3-yl]benzamide.
| Compound Name | 3-chloro-2-fluoro-N-[(3R)-1-[(3-methylimidazol-4-yl)methyl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 166287232 |
| Molecular Formula | C17H20ClFN4O |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-chloro-2-fluoro-N-[(3R)-1-[(3-methylimidazol-4-yl)methyl]piperidin-3-yl]benzamide |
| SMILES | Cn1cncc1CN1CCC[C@@H](NC(=O)c2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C17H20ClFN4O/c1-22-11-20-8-13(22)10-23-7-3-4-12(9-23)21-17(24)14-5-2-6-15(18)16(14)19/h2,5-6,8,11-12H,3-4,7,9-10H2,1H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | RDCNLHSOQHPPDN-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |