C27H29ClN2O — CID 134802067
2-chloro-N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide (PubChem CID 134802067) has the molecular formula C27H29ClN2O and a molecular weight of 433.00 g/mol. Its IUPAC name is 2-chloro-N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 134802067 |
| Molecular Formula | C27H29ClN2O |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-chloro-N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide |
| SMILES | Cc1cc(C)cc(-c2ccc(CN3CCCC(NC(=O)c4ccccc4Cl)C3)cc2)c1 |
| InChI | InChI=1S/C27H29ClN2O/c1-19-14-20(2)16-23(15-19)22-11-9-21(10-12-22)17-30-13-5-6-24(18-30)29-27(31)25-7-3-4-8-26(25)28/h3-4,7-12,14-16,24H,5-6,13,17-18H2,1-2H3,(H,29,31) |
| InChIKey | ZAGBJZRXHSXHDS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |