C27H30N2O — CID 134801576
N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide (PubChem CID 134801576) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide.
| Compound Name | N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 134801576 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[1-[[4-(3,5-dimethylphenyl)phenyl]methyl]piperidin-3-yl]benzamide |
| SMILES | Cc1cc(C)cc(-c2ccc(CN3CCCC(NC(=O)c4ccccc4)C3)cc2)c1 |
| InChI | InChI=1S/C27H30N2O/c1-20-15-21(2)17-25(16-20)23-12-10-22(11-13-23)18-29-14-6-9-26(19-29)28-27(30)24-7-4-3-5-8-24/h3-5,7-8,10-13,15-17,26H,6,9,14,18-19H2,1-2H3,(H,28,30) |
| InChIKey | LLMOEPMODJRVEO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |