C19H18BrFN4O3 — CID 166287260
2-[4-(3-bromo-4-methoxyphenyl)triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide (PubChem CID 166287260) has the molecular formula C19H18BrFN4O3 and a molecular weight of 449.28 g/mol. Its IUPAC name is 2-[4-(3-bromo-4-methoxyphenyl)triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-[4-(3-bromo-4-methoxyphenyl)triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 166287260 |
| Molecular Formula | C19H18BrFN4O3 |
| Molecular Weight | 449.28 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[4-(3-bromo-4-methoxyphenyl)triazol-1-yl]-N-[2-(3-fluorophenoxy)ethyl]acetamide |
| SMILES | COc1ccc(-c2cn(CC(=O)NCCOc3cccc(F)c3)nn2)cc1Br |
| InChI | InChI=1S/C19H18BrFN4O3/c1-27-18-6-5-13(9-16(18)20)17-11-25(24-23-17)12-19(26)22-7-8-28-15-4-2-3-14(21)10-15/h2-6,9-11H,7-8,12H2,1H3,(H,22,26) |
| InChIKey | IHKWLPYJWPQKBE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|