C13H14F2N2O4S — CID 166289280
4,4-difluoro-3-(1H-indol-3-ylsulfonylamino)-3-methylbutanoic acid (PubChem CID 166289280) has the molecular formula C13H14F2N2O4S and a molecular weight of 332.33 g/mol. Its IUPAC name is 4,4-difluoro-3-(1H-indol-3-ylsulfonylamino)-3-methylbutanoic acid.
| Compound Name | 4,4-difluoro-3-(1H-indol-3-ylsulfonylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 166289280 |
| Molecular Formula | C13H14F2N2O4S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4,4-difluoro-3-(1H-indol-3-ylsulfonylamino)-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)(NS(=O)(=O)c1c[nH]c2ccccc12)C(F)F |
| InChI | InChI=1S/C13H14F2N2O4S/c1-13(12(14)15,6-11(18)19)17-22(20,21)10-7-16-9-5-3-2-4-8(9)10/h2-5,7,12,16-17H,6H2,1H3,(H,18,19) |
| InChIKey | HUMSEYQRMOZTQK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |