C16H16FNO4S — CID 166289591
4-[2-(2-fluoro-4-propan-2-yloxyanilino)-2-oxoethyl]thiophene-2-carboxylic acid (PubChem CID 166289591) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is 4-[2-(2-fluoro-4-propan-2-yloxyanilino)-2-oxoethyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-(2-fluoro-4-propan-2-yloxyanilino)-2-oxoethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 166289591 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[2-(2-fluoro-4-propan-2-yloxyanilino)-2-oxoethyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)Oc1ccc(NC(=O)Cc2csc(C(=O)O)c2)c(F)c1 |
| InChI | InChI=1S/C16H16FNO4S/c1-9(2)22-11-3-4-13(12(17)7-11)18-15(19)6-10-5-14(16(20)21)23-8-10/h3-5,7-9H,6H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | MIEMOCOUEUBIFR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |