C15H17ClFNO5 — CID 166289871
2-chloro-3-[[1-fluoro-3-(hydroxymethyl)cyclobutyl]methylcarbamoyl]-5-methoxybenzoic acid (PubChem CID 166289871) has the molecular formula C15H17ClFNO5 and a molecular weight of 345.75 g/mol. Its IUPAC name is 2-chloro-3-[[1-fluoro-3-(hydroxymethyl)cyclobutyl]methylcarbamoyl]-5-methoxybenzoic acid.
| Compound Name | 2-chloro-3-[[1-fluoro-3-(hydroxymethyl)cyclobutyl]methylcarbamoyl]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 166289871 |
| Molecular Formula | C15H17ClFNO5 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-chloro-3-[[1-fluoro-3-(hydroxymethyl)cyclobutyl]methylcarbamoyl]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(Cl)c(C(=O)NCC2(F)CC(CO)C2)c1 |
| InChI | InChI=1S/C15H17ClFNO5/c1-23-9-2-10(12(16)11(3-9)14(21)22)13(20)18-7-15(17)4-8(5-15)6-19/h2-3,8,19H,4-7H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | UMRKSHNRVKVCIO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |