C12H11F5N6 — CID 166291713
3-(1,1,2,2,2-pentafluoroethyl)-6-[(2S)-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]pyridazine (PubChem CID 166291713) has the molecular formula C12H11F5N6 and a molecular weight of 334.25 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-6-[(2S)-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]pyridazine.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-6-[(2S)-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]pyridazine |
|---|---|
| PubChem CID | 166291713 |
| Molecular Formula | C12H11F5N6 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-6-[(2S)-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]pyridazine |
| SMILES | FC(F)(F)C(F)(F)c1ccc(N2CCC[C@H]2c2ncn[nH]2)nn1 |
| InChI | InChI=1S/C12H11F5N6/c13-11(14,12(15,16)17)8-3-4-9(21-20-8)23-5-1-2-7(23)10-18-6-19-22-10/h3-4,6-7H,1-2,5H2,(H,18,19,22)/t7-/m0/s1 |
| InChIKey | XBTAPNTYRGQYGA-ZETCQYMHSA-N |
| XLogP | 2.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|