About 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine
4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine (PubChem CID 167992138) has the molecular formula C12H16N6O
and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine |
| PubChem CID | 167992138 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine |
| SMILES | COc1ccnc(N2CCCCC2c2ncn[nH]2)n1 |
| InChI | InChI=1S/C12H16N6O/c1-19-10-5-6-13-12(16-10)18-7-3-2-4-9(18)11-14-8-15-17-11/h5-6,8-9H,2-4,7H2,1H3,(H,14,15,17) |
| InChIKey | PKPOGPVPGWOOHB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine?
The IUPAC name of 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine (CID 167992138) is 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine.
What is the SMILES notation for 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine?
The canonical SMILES for 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine is COc1ccnc(N2CCCCC2c2ncn[nH]2)n1.
What is the InChIKey of 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine?
The InChIKey is PKPOGPVPGWOOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6O/c1-19-10-5-6-13-12(16-10)18-7-3-2-4-9(18)11-14-8-15-17-11/h5-6,8-9H,2-4,7H2,1H3,(H,14,15,17).
What are the key properties of 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine?
4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine has a molecular weight of 260.30 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrimidine is sourced from PubChem (CID 167992138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).