C13H20N4O — CID 167867544
7-(4-methoxypyrimidin-2-yl)-1,7-diazabicyclo[4.3.1]decane (PubChem CID 167867544) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 7-(4-methoxypyrimidin-2-yl)-1,7-diazabicyclo[4.3.1]decane.
| Compound Name | 7-(4-methoxypyrimidin-2-yl)-1,7-diazabicyclo[4.3.1]decane |
|---|---|
| PubChem CID | 167867544 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 7-(4-methoxypyrimidin-2-yl)-1,7-diazabicyclo[4.3.1]decane |
| SMILES | COc1ccnc(N2CCN3CCCCC2C3)n1 |
| InChI | InChI=1S/C13H20N4O/c1-18-12-5-6-14-13(15-12)17-9-8-16-7-3-2-4-11(17)10-16/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | OXCMEUKNHZGUNC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |