C18H17ClFNO3 — CID 166295366
3-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrolidin-3-yl]oxybenzoic acid (PubChem CID 166295366) has the molecular formula C18H17ClFNO3 and a molecular weight of 349.79 g/mol. Its IUPAC name is 3-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrolidin-3-yl]oxybenzoic acid.
| Compound Name | 3-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrolidin-3-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 166295366 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-[1-[(2-chloro-4-fluorophenyl)methyl]pyrrolidin-3-yl]oxybenzoic acid |
| SMILES | O=C(O)c1cccc(OC2CCN(Cc3ccc(F)cc3Cl)C2)c1 |
| InChI | InChI=1S/C18H17ClFNO3/c19-17-9-14(20)5-4-13(17)10-21-7-6-16(11-21)24-15-3-1-2-12(8-15)18(22)23/h1-5,8-9,16H,6-7,10-11H2,(H,22,23) |
| InChIKey | DDBCPRYQDFVERG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |